C35H33N3O4S — CID 23869291
(5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869291) has the molecular formula C35H33N3O4S and a molecular weight of 591.73 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869291 |
| Molecular Formula | C35H33N3O4S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@@]12CCC3(S1)C(C(=O)Nc1ccc4ccccc4c1)N([C@H](CO)c1ccccc1)C(=O)[C@@H]3[C@@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C35H33N3O4S/c1-34-18-19-35(43-34)29(28(34)31(40)36-25-14-6-3-7-15-25)33(42)38(27(21-39)23-11-4-2-5-12-23)30(35)32(41)37-26-17-16-22-10-8-9-13-24(22)20-26/h2-17,20,27-30,39H,18-19,21H2,1H3,(H,36,40)(H,37,41)/t27-,28-,29+,30?,34+,35?/m1/s1 |
| InChIKey | DDEDJIGETUEFKE-WNAFNNAMSA-N |
| XLogP | 5.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |