C22H28ClN3O5 — CID 23870214
(5R,6S,7S)-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870214) has the molecular formula C22H28ClN3O5 and a molecular weight of 449.94 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870214 |
| Molecular Formula | C22H28ClN3O5 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)Nc3ccc(Cl)cc3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C22H28ClN3O5/c1-11-9-22-16(15(18(28)24-4)21(11,3)31-22)20(30)26(12(2)10-27)17(22)19(29)25-14-7-5-13(23)6-8-14/h5-8,11-12,15-17,27H,9-10H2,1-4H3,(H,24,28)(H,25,29)/t11?,12-,15-,16+,17?,21+,22?/m1/s1 |
| InChIKey | DSTSDUNRJREMSQ-CAAAJMNFSA-N |
| XLogP | 1.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |