C33H43N3O6 — CID 23811937
(5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811937) has the molecular formula C33H43N3O6 and a molecular weight of 577.72 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811937 |
| Molecular Formula | C33H43N3O6 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)Nc4cc(C)ccc4C)C34CC[C@@]2(C)O4)cc1 |
| InChI | InChI=1S/C33H43N3O6/c1-5-41-24-14-12-23(13-15-24)34-29(38)26-27-31(40)36(18-8-6-7-9-19-37)28(33(27)17-16-32(26,4)42-33)30(39)35-25-20-21(2)10-11-22(25)3/h10-15,20,26-28,37H,5-9,16-19H2,1-4H3,(H,34,38)(H,35,39)/t26-,27-,28?,32+,33?/m0/s1 |
| InChIKey | XZJCLTBRNYZENF-XCQZOCOHSA-N |
| XLogP | 4.60 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|