C28H33N3O7 — CID 23811294
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811294) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811294 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-2-N-(4-methoxyphenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCO)C(C(=O)Nc4ccc(OC)cc4)C34CC[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C28H33N3O7/c1-4-37-20-11-7-17(8-12-20)29-24(33)21-22-26(35)31(15-16-32)23(28(22)14-13-27(21,2)38-28)25(34)30-18-5-9-19(36-3)10-6-18/h5-12,21-23,32H,4,13-16H2,1-3H3,(H,29,33)(H,30,34)/t21-,22+,23?,27+,28?/m1/s1 |
| InChIKey | PNOXZIZXKDYQRD-YWLJYNQQSA-N |
| XLogP | 2.43 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |