C25H35N3O6 — CID 23952611
(5R,6R,7R)-3-(6-hydroxyhexyl)-2-N-(4-methoxyphenyl)-6-N,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952611) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is (5R,6R,7R)-3-(6-hydroxyhexyl)-2-N-(4-methoxyphenyl)-6-N,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-3-(6-hydroxyhexyl)-2-N-(4-methoxyphenyl)-6-N,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952611 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (5R,6R,7R)-3-(6-hydroxyhexyl)-2-N-(4-methoxyphenyl)-6-N,7-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)Nc3ccc(OC)cc3)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C25H35N3O6/c1-24-12-13-25(34-24)19(18(24)21(30)26-2)23(32)28(14-6-4-5-7-15-29)20(25)22(31)27-16-8-10-17(33-3)11-9-16/h8-11,18-20,29H,4-7,12-15H2,1-3H3,(H,26,30)(H,27,31)/t18-,19-,20?,24+,25?/m0/s1 |
| InChIKey | HPUCDRMCYPXSPX-AQSYCGSKSA-N |
| XLogP | 1.70 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|