C24H31ClN2O6 — CID 23922781
ethyl (5R,6R,7R)-2-[(2-chlorophenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23922781) has the molecular formula C24H31ClN2O6 and a molecular weight of 478.97 g/mol. Its IUPAC name is ethyl (5R,6R,7R)-2-[(2-chlorophenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6R,7R)-2-[(2-chlorophenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23922781 |
| Molecular Formula | C24H31ClN2O6 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl (5R,6R,7R)-2-[(2-chlorophenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)Nc3ccccc3Cl)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C24H31ClN2O6/c1-5-14(12-28)27-19(20(29)26-16-10-8-7-9-15(16)25)24-11-13(3)23(4,33-24)18(17(24)21(27)30)22(31)32-6-2/h7-10,13-14,17-19,28H,5-6,11-12H2,1-4H3,(H,26,29)/t13?,14-,17-,18-,19?,23+,24?/m0/s1 |
| InChIKey | MEFGYENXNTYCMP-BRIOPDPCSA-N |
| XLogP | 2.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |