C25H42N2O6 — CID 23838607
ethyl (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838607) has the molecular formula C25H42N2O6 and a molecular weight of 466.62 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838607 |
| Molecular Formula | C25H42N2O6 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | ethyl (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-2-(pentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCCC(C)NC(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@@]3(C)OC12CC3C |
| InChI | InChI=1S/C25H42N2O6/c1-8-10-16(6)26-21(29)20-25-12-15(5)24(7,33-25)19(23(31)32-9-2)18(25)22(30)27(20)17(13-28)11-14(3)4/h14-20,28H,8-13H2,1-7H3,(H,26,29)/t15?,16?,17-,18+,19-,20?,24+,25?/m1/s1 |
| InChIKey | SHYZEWTXJLXLQT-JNMDYCPFSA-N |
| XLogP | 2.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |