C27H45N3O5 — CID 23926287
(5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926287) has the molecular formula C27H45N3O5 and a molecular weight of 491.67 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926287 |
| Molecular Formula | C27H45N3O5 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)NC3CCCCC3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C27H45N3O5/c1-6-12-28-23(32)20-21-25(34)30(19(15-31)13-16(2)3)22(24(33)29-18-10-8-7-9-11-18)27(21)14-17(4)26(20,5)35-27/h16-22,31H,6-15H2,1-5H3,(H,28,32)(H,29,33)/t17?,19-,20-,21+,22?,26+,27?/m1/s1 |
| InChIKey | ZKCBVIWPQKUPPV-PZVKLLKASA-N |
| XLogP | 2.38 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |