C32H32ClN3O4S — CID 23952881
(5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952881) has the molecular formula C32H32ClN3O4S and a molecular weight of 590.15 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952881 |
| Molecular Formula | C32H32ClN3O4S |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | (5S,6R,7S)-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@@]12CCC3(S1)C(C(=O)Nc1ccccc1Cl)N([C@@H](CO)Cc1ccccc1)C(=O)[C@@H]3[C@@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H32ClN3O4S/c1-31-16-17-32(41-31)26(25(31)28(38)34-21-12-6-3-7-13-21)30(40)36(22(19-37)18-20-10-4-2-5-11-20)27(32)29(39)35-24-15-9-8-14-23(24)33/h2-15,22,25-27,37H,16-19H2,1H3,(H,34,38)(H,35,39)/t22-,25-,26+,27?,31+,32?/m1/s1 |
| InChIKey | JHYZXMUHRYTNTE-GFDWNIIRSA-N |
| XLogP | 5.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |