C30H36ClN3O4S — CID 23869496
(5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869496) has the molecular formula C30H36ClN3O4S and a molecular weight of 570.16 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869496 |
| Molecular Formula | C30H36ClN3O4S |
| Molecular Weight | 570.16 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@]12CCC3(S1)C(C(=O)Nc1ccc(Cl)cc1)N(CCCCCCO)C(=O)[C@@H]3[C@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H36ClN3O4S/c1-29-15-16-30(39-29)24(23(29)26(36)32-19-20-9-5-4-6-10-20)28(38)34(17-7-2-3-8-18-35)25(30)27(37)33-22-13-11-21(31)12-14-22/h4-6,9-14,23-25,35H,2-3,7-8,15-19H2,1H3,(H,32,36)(H,33,37)/t23-,24-,25?,29+,30?/m0/s1 |
| InChIKey | UWCAPJGRDRSFNR-JHEDDYHUSA-N |
| XLogP | 4.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.16 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|