C26H38N4O4S — CID 23925148
(5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(4-hydroxybutyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925148) has the molecular formula C26H38N4O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(4-hydroxybutyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(4-hydroxybutyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925148 |
| Molecular Formula | C26H38N4O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(4-hydroxybutyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCCO)C(=O)[C@@H]3[C@H](C(=O)NC)[C@]4(C)CCC23S4)cc1 |
| InChI | InChI=1S/C26H38N4O4S/c1-5-29(6-2)18-11-9-17(10-12-18)28-23(33)21-26-14-13-25(3,35-26)19(22(32)27-4)20(26)24(34)30(21)15-7-8-16-31/h9-12,19-21,31H,5-8,13-16H2,1-4H3,(H,27,32)(H,28,33)/t19-,20+,21?,25+,26?/m1/s1 |
| InChIKey | OWRMFHCBDHQSRC-FQKPGTOISA-N |
| XLogP | 2.47 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|