C24H39N3O4S — CID 23953225
(5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953225) has the molecular formula C24H39N3O4S and a molecular weight of 465.66 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953225 |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-3-(6-hydroxyhexyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)NC3CCCCC3)C23CC[C@@]1(C)S3 |
| InChI | InChI=1S/C24H39N3O4S/c1-23-12-13-24(32-23)18(17(23)20(29)25-2)22(31)27(14-8-3-4-9-15-28)19(24)21(30)26-16-10-6-5-7-11-16/h16-19,28H,3-15H2,1-2H3,(H,25,29)(H,26,30)/t17-,18-,19?,23+,24?/m0/s1 |
| InChIKey | WKVNVGCDCQBYJG-TUMHKSBJSA-N |
| XLogP | 2.22 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|