C18H29N3O4S — CID 23840826
(5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840826) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840826 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (5S,6R,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)NC(C)(C)C)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C18H29N3O4S/c1-16(2,3)20-14(24)12-18-7-6-17(4,26-18)10(13(23)19-5)11(18)15(25)21(12)8-9-22/h10-12,22H,6-9H2,1-5H3,(H,19,23)(H,20,24)/t10-,11+,12?,17+,18?/m1/s1 |
| InChIKey | BKJRSKBTNYKEFM-ZNUXJZFQSA-N |
| XLogP | 0.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |