C23H39N3O5 — CID 23954413
(5R,6R,7R)-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954413) has the molecular formula C23H39N3O5 and a molecular weight of 437.58 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954413 |
| Molecular Formula | C23H39N3O5 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | (5R,6R,7R)-2-N-tert-butyl-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)NC(C)(C)C)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C23H39N3O5/c1-14-13-23-16(15(18(28)24-6)22(14,5)31-23)20(30)26(11-9-7-8-10-12-27)17(23)19(29)25-21(2,3)4/h14-17,27H,7-13H2,1-6H3,(H,24,28)(H,25,29)/t14?,15-,16-,17?,22+,23?/m0/s1 |
| InChIKey | DNTWFXBBEFVQFV-DFQFRUGLSA-N |
| XLogP | 1.21 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|