C24H41N3O4S — CID 23754185
(5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754185) has the molecular formula C24H41N3O4S and a molecular weight of 467.68 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754185 |
| Molecular Formula | C24H41N3O4S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N,7-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NC)[C@]3(C)CCC2(S3)C1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H41N3O4S/c1-9-14(12-28)27-17(19(30)26-22(5,6)13-21(2,3)4)24-11-10-23(7,32-24)15(18(29)25-8)16(24)20(27)31/h14-17,28H,9-13H2,1-8H3,(H,25,29)(H,26,30)/t14-,15+,16-,17?,23-,24?/m0/s1 |
| InChIKey | LVVLDYRJHAOYCC-CZPMQETBSA-N |
| XLogP | 2.32 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |