C23H39N3O4S — CID 25075456
(5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25075456) has the molecular formula C23H39N3O4S and a molecular weight of 453.65 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25075456 |
| Molecular Formula | C23H39N3O4S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NC)[C@@H]3CCC2(S3)C1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C23H39N3O4S/c1-8-13(11-27)26-17(19(29)25-22(5,6)12-21(2,3)4)23-10-9-14(31-23)15(18(28)24-7)16(23)20(26)30/h13-17,27H,8-12H2,1-7H3,(H,24,28)(H,25,29)/t13-,14-,15+,16-,17?,23?/m0/s1 |
| InChIKey | RSAPKPUMPIQZSN-KQQFAKRXSA-N |
| XLogP | 1.93 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |