C22H36N2O5S — CID 25076686
ethyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25076686) has the molecular formula C22H36N2O5S and a molecular weight of 440.61 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25076686 |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ethyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)NC(C)(C)CC(C)(C)C)N(CCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C22H36N2O5S/c1-7-29-19(28)14-13-8-9-22(30-13)15(14)18(27)24(10-11-25)16(22)17(26)23-21(5,6)12-20(2,3)4/h13-16,25H,7-12H2,1-6H3,(H,23,26)/t13-,14+,15-,16?,22?/m0/s1 |
| InChIKey | HCMIBCYPUHSBQI-ACRLXMGDSA-N |
| XLogP | 1.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |