C25H42N2O5S — CID 25080421
ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25080421) has the molecular formula C25H42N2O5S and a molecular weight of 482.69 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25080421 |
| Molecular Formula | C25H42N2O5S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)NC(C)(C)CC(C)(C)C)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C25H42N2O5S/c1-8-32-22(31)17-16-13-15(2)25(33-16)18(17)21(30)27(11-9-10-12-28)19(25)20(29)26-24(6,7)14-23(3,4)5/h15-19,28H,8-14H2,1-7H3,(H,26,29)/t15?,16-,17+,18-,19?,25?/m0/s1 |
| InChIKey | AWPHVENLQYYWNM-MGRDVQPMSA-N |
| XLogP | 2.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|