C29H42N2O5S — CID 23894847
ethyl (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23894847) has the molecular formula C29H42N2O5S and a molecular weight of 530.73 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23894847 |
| Molecular Formula | C29H42N2O5S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | ethyl (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)NC(C)(C)CC(C)(C)C)N([C@H](CO)c2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C29H42N2O5S/c1-8-36-26(35)21-20-14-17(2)29(37-20)22(21)25(34)31(19(15-32)18-12-10-9-11-13-18)23(29)24(33)30-28(6,7)16-27(3,4)5/h9-13,17,19-23,32H,8,14-16H2,1-7H3,(H,30,33)/t17?,19-,20+,21-,22+,23?,29?/m1/s1 |
| InChIKey | UWQQNPKYOMMHFM-LSWZJHLZSA-N |
| XLogP | 3.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |