C32H33N3O5S — CID 23925603
(5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925603) has the molecular formula C32H33N3O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925603 |
| Molecular Formula | C32H33N3O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2N([C@H](CO)c3ccccc3)C(=O)[C@@H]3[C@H](C(=O)Nc4ccccc4)[C@@H]4CC(C)C23S4)cc1 |
| InChI | InChI=1S/C32H33N3O5S/c1-19-17-25-26(29(37)33-21-11-7-4-8-12-21)27-31(39)35(24(18-36)20-9-5-3-6-10-20)28(32(19,27)41-25)30(38)34-22-13-15-23(40-2)16-14-22/h3-16,19,24-28,36H,17-18H2,1-2H3,(H,33,37)(H,34,38)/t19?,24-,25+,26-,27+,28?,32?/m1/s1 |
| InChIKey | SKDBWAWWDXFWRN-VAYMTEOVSA-N |
| XLogP | 4.34 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |