C32H32N6O4S — CID 23981795
(5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981795) has the molecular formula C32H32N6O4S and a molecular weight of 596.71 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981795 |
| Molecular Formula | C32H32N6O4S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1C[C@H]2SC13C(C(=O)NCn1nnc4ccccc41)N([C@H](CO)c1ccccc1)C(=O)[C@@H]3[C@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C32H32N6O4S/c1-19-16-25-26(29(40)34-21-12-6-3-7-13-21)27-31(42)38(24(17-39)20-10-4-2-5-11-20)28(32(19,27)43-25)30(41)33-18-37-23-15-9-8-14-22(23)35-36-37/h2-15,19,24-28,39H,16-18H2,1H3,(H,33,41)(H,34,40)/t19?,24-,25-,26+,27+,28?,32?/m1/s1 |
| InChIKey | NLSOVOCBBRGPJW-UTWUKABHSA-N |
| XLogP | 3.21 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |