C31H38N4O5S — CID 23897629
(5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897629) has the molecular formula C31H38N4O5S and a molecular weight of 578.74 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897629 |
| Molecular Formula | C31H38N4O5S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | (5S,6R,7S)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1C[C@@H]2SC13C(C(=O)NCCN1CCOCC1)N([C@H](CO)c1ccccc1)C(=O)[C@@H]3[C@@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C31H38N4O5S/c1-20-18-24-25(28(37)33-22-10-6-3-7-11-22)26-30(39)35(23(19-36)21-8-4-2-5-9-21)27(31(20,26)41-24)29(38)32-12-13-34-14-16-40-17-15-34/h2-11,20,23-27,36H,12-19H2,1H3,(H,32,38)(H,33,37)/t20?,23-,24+,25-,26+,27?,31?/m1/s1 |
| InChIKey | SQROUCZBNGWGGG-YKSNKEDISA-N |
| XLogP | 2.14 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |