C31H38N6O5S — CID 23784088
(5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784088) has the molecular formula C31H38N6O5S and a molecular weight of 606.75 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784088 |
| Molecular Formula | C31H38N6O5S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCCO)C(C(=O)NCn4nnc5ccccc54)C34S[C@@H]2CC4C)cc1 |
| InChI | InChI=1S/C31H38N6O5S/c1-3-42-21-13-11-20(12-14-21)33-28(39)25-24-17-19(2)31(43-24)26(25)30(41)36(15-7-4-8-16-38)27(31)29(40)32-18-37-23-10-6-5-9-22(23)34-35-37/h5-6,9-14,19,24-27,38H,3-4,7-8,15-18H2,1-2H3,(H,32,40)(H,33,39)/t19?,24-,25+,26+,27?,31?/m1/s1 |
| InChIKey | FNSBREDDQRUKPR-NCBQPTDYSA-N |
| XLogP | 3.04 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|