C27H30N6O5S — CID 23897239
(5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897239) has the molecular formula C27H30N6O5S and a molecular weight of 550.64 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897239 |
| Molecular Formula | C27H30N6O5S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | (5S,6S,7R)-2-N-(benzotriazol-1-ylmethyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCO)C(C(=O)NCn4nnc5ccccc54)C34CC[C@H]2S4)cc1 |
| InChI | InChI=1S/C27H30N6O5S/c1-2-38-17-9-7-16(8-10-17)29-24(35)21-20-11-12-27(39-20)22(21)26(37)32(13-14-34)23(27)25(36)28-15-33-19-6-4-3-5-18(19)30-31-33/h3-10,20-23,34H,2,11-15H2,1H3,(H,28,36)(H,29,35)/t20-,21+,22+,23?,27?/m1/s1 |
| InChIKey | IRZNPTYUEPGCLY-SAFCFDRRSA-N |
| XLogP | 1.63 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |