C21H26N6O4S — CID 23924991
(5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924991) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924991 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)NCn2nnc4ccccc42)N([C@H](C)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C21H26N6O4S/c1-11(9-28)27-17(19(30)23-10-26-13-6-4-3-5-12(13)24-25-26)21-8-7-14(32-21)15(18(29)22-2)16(21)20(27)31/h3-6,11,14-17,28H,7-10H2,1-2H3,(H,22,29)(H,23,30)/t11-,14+,15-,16+,17?,21?/m1/s1 |
| InChIKey | HUTSXQOPVWPWCP-KBYSJQPKSA-N |
| XLogP | -0.28 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |