C33H34N6O4S — CID 23897038
(5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897038) has the molecular formula C33H34N6O4S and a molecular weight of 610.74 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897038 |
| Molecular Formula | C33H34N6O4S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (5S,6R,7S)-2-N-(benzotriazol-1-ylmethyl)-6-N-benzyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NCn1nnc2ccccc21)C1N([C@@H](CO)Cc2ccccc2)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C33H34N6O4S/c40-19-23(17-21-9-3-1-4-10-21)39-29(31(42)35-20-38-25-14-8-7-13-24(25)36-37-38)33-16-15-26(44-33)27(28(33)32(39)43)30(41)34-18-22-11-5-2-6-12-22/h1-14,23,26-29,40H,15-20H2,(H,34,41)(H,35,42)/t23-,26+,27-,28+,29?,33?/m1/s1 |
| InChIKey | RCTNFEICWGLHNB-WUCGQRHOSA-N |
| XLogP | 2.52 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |