C28H41N3O4S — CID 23754268
(5S,6S,7R)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754268) has the molecular formula C28H41N3O4S and a molecular weight of 515.72 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754268 |
| Molecular Formula | C28H41N3O4S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)C1N(C(CO)CC(C)C)C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@H]3CCC12S3 |
| InChI | InChI=1S/C28H41N3O4S/c1-4-5-9-14-29-26(34)24-28-13-12-21(36-28)22(25(33)30-16-19-10-7-6-8-11-19)23(28)27(35)31(24)20(17-32)15-18(2)3/h6-8,10-11,18,20-24,32H,4-5,9,12-17H2,1-3H3,(H,29,34)(H,30,33)/t20?,21-,22+,23+,24?,28?/m1/s1 |
| InChIKey | PRRAHWLKWSXWSC-QMAJWLLZSA-N |
| XLogP | 3.11 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|