C33H37N3O5S — CID 23953507
(5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-2-N-naphthalen-2-yl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953507) has the molecular formula C33H37N3O5S and a molecular weight of 587.74 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-2-N-naphthalen-2-yl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-2-N-naphthalen-2-yl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953507 |
| Molecular Formula | C33H37N3O5S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-2-N-naphthalen-2-yl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@@H]3CC(C)C4(S3)C(C(=O)Nc3ccc5ccccc5c3)N([C@@H](CC)CO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C33H37N3O5S/c1-4-24(18-37)36-29(31(39)35-23-11-10-20-8-6-7-9-21(20)17-23)33-19(3)16-26(42-33)27(28(33)32(36)40)30(38)34-22-12-14-25(15-13-22)41-5-2/h6-15,17,19,24,26-29,37H,4-5,16,18H2,1-3H3,(H,34,38)(H,35,39)/t19?,24-,26-,27+,28-,29?,33?/m0/s1 |
| InChIKey | RXLPBXNPAFWOOE-KLLSDKJXSA-N |
| XLogP | 4.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |