C24H32ClN3O4S — CID 23981801
(5S,6S,7R)-2-N-(4-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981801) has the molecular formula C24H32ClN3O4S and a molecular weight of 494.06 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(4-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981801 |
| Molecular Formula | C24H32ClN3O4S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (5S,6S,7R)-2-N-(4-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)Nc3ccc(Cl)cc3)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C24H32ClN3O4S/c1-4-10-26-21(30)18-17-11-13(3)24(33-17)19(18)23(32)28(16(5-2)12-29)20(24)22(31)27-15-8-6-14(25)7-9-15/h6-9,13,16-20,29H,4-5,10-12H2,1-3H3,(H,26,30)(H,27,31)/t13?,16?,17-,18+,19+,20?,24?/m1/s1 |
| InChIKey | WXEUQALZKDNPBL-DQYMHTBDSA-N |
| XLogP | 2.91 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |