C31H39N3O5S — CID 23898068
(5S,6S,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898068) has the molecular formula C31H39N3O5S and a molecular weight of 565.74 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898068 |
| Molecular Formula | C31H39N3O5S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | (5S,6S,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(C(CC)CO)C(C(=O)Nc4cc(C)ccc4C)C34S[C@@H]2CC4C)cc1 |
| InChI | InChI=1S/C31H39N3O5S/c1-6-21(16-35)34-27(29(37)33-23-14-17(3)8-9-18(23)4)31-19(5)15-24(40-31)25(26(31)30(34)38)28(36)32-20-10-12-22(13-11-20)39-7-2/h8-14,19,21,24-27,35H,6-7,15-16H2,1-5H3,(H,32,36)(H,33,37)/t19?,21?,24-,25+,26+,27?,31?/m1/s1 |
| InChIKey | JANHTIJEPCDFAC-VIZSVNHISA-N |
| XLogP | 4.39 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |