C32H41N3O5S — CID 23953842
(5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953842) has the molecular formula C32H41N3O5S and a molecular weight of 579.76 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953842 |
| Molecular Formula | C32H41N3O5S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (5S,6S,7R)-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)C(C)C)C(C(=O)Nc4c(C)cccc4C)C34S[C@@H]2CC4C)cc1 |
| InChI | InChI=1S/C32H41N3O5S/c1-7-40-22-13-11-21(12-14-22)33-29(37)25-24-15-20(6)32(41-24)26(25)31(39)35(23(16-36)17(2)3)28(32)30(38)34-27-18(4)9-8-10-19(27)5/h8-14,17,20,23-26,28,36H,7,15-16H2,1-6H3,(H,33,37)(H,34,38)/t20?,23-,24+,25-,26-,28?,32?/m0/s1 |
| InChIKey | RLJDCBMAMKVDFV-WAKUMEGZSA-N |
| XLogP | 4.63 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |