C35H48N4O5S — CID 23981700
(5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981700) has the molecular formula C35H48N4O5S and a molecular weight of 636.86 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981700 |
| Molecular Formula | C35H48N4O5S |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc4ccc(N(CC)CC)cc4)C34S[C@@H]2CC4C)cc1 |
| InChI | InChI=1S/C35H48N4O5S/c1-7-21(5)27(20-40)39-31(33(42)37-23-11-15-25(16-12-23)38(8-2)9-3)35-22(6)19-28(45-35)29(30(35)34(39)43)32(41)36-24-13-17-26(18-14-24)44-10-4/h11-18,21-22,27-31,40H,7-10,19-20H2,1-6H3,(H,36,41)(H,37,42)/t21-,22?,27-,28+,29-,30-,31?,35?/m0/s1 |
| InChIKey | KGYQKVJRGMRZNU-QXUIKPAVSA-N |
| XLogP | 5.25 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|