C30H37N3O4S — CID 23898069
(5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898069) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898069 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCC(CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@H]3CC(C)C2(S3)C1C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C30H37N3O4S/c1-5-21(16-34)33-26(28(36)32-22-13-17(2)11-12-18(22)3)30-19(4)14-23(38-30)24(25(30)29(33)37)27(35)31-15-20-9-7-6-8-10-20/h6-13,19,21,23-26,34H,5,14-16H2,1-4H3,(H,31,35)(H,32,36)/t19?,21?,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | GWWPRPSXSADMFS-YLEBRNCBSA-N |
| XLogP | 3.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |