C24H41N3O4S — CID 25092925
(5S,6R,7S)-2-N-butyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25092925) has the molecular formula C24H41N3O4S and a molecular weight of 467.68 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-butyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-butyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25092925 |
| Molecular Formula | C24H41N3O4S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (5S,6R,7S)-2-N-butyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N([C@@H](CO)[C@@H](C)CC)C(=O)[C@@H]2[C@H](C(=O)NCCC)[C@@H]3CC(C)C12S3 |
| InChI | InChI=1S/C24H41N3O4S/c1-6-9-11-26-22(30)20-24-15(5)12-17(32-24)18(21(29)25-10-7-2)19(24)23(31)27(20)16(13-28)14(4)8-3/h14-20,28H,6-13H2,1-5H3,(H,25,29)(H,26,30)/t14-,15?,16-,17-,18+,19-,20?,24?/m0/s1 |
| InChIKey | KASDJGQZBKYQIM-YBYNWEFVSA-N |
| XLogP | 2.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|