C24H40N2O5S — CID 25089708
ethyl (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25089708) has the molecular formula C24H40N2O5S and a molecular weight of 468.66 g/mol. Its IUPAC name is ethyl (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25089708 |
| Molecular Formula | C24H40N2O5S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | ethyl (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)NC(C)(C)CC(C)(C)C)C23CC[C@H]1S3 |
| InChI | InChI=1S/C24H40N2O5S/c1-8-14(12-27)26-18(19(28)25-23(6,7)13-22(3,4)5)24-11-10-15(32-24)16(17(24)20(26)29)21(30)31-9-2/h14-18,27H,8-13H2,1-7H3,(H,25,28)/t14?,15-,16+,17+,18?,24?/m1/s1 |
| InChIKey | ULHIZVKWMDXLIW-IJKMVRBLSA-N |
| XLogP | 2.74 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |