C29H46N2O5S — CID 25089313
but-3-enyl (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25089313) has the molecular formula C29H46N2O5S and a molecular weight of 534.76 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25089313 |
| Molecular Formula | C29H46N2O5S |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | but-3-enyl (5S,6R,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)N(C(CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C29H46N2O5S/c1-9-12-16-36-26(35)21-20-13-14-29(37-20)22(21)24(33)31(19(11-3)17-32)23(29)25(34)30(15-10-2)28(7,8)18-27(4,5)6/h9-10,19-23,32H,1-2,11-18H2,3-8H3/t19?,20-,21+,22-,23?,29?/m0/s1 |
| InChIKey | HXRJDKVPUWDWJK-WBMIHLQBSA-N |
| XLogP | 4.20 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|