C33H54N2O5S — CID 25080480
hex-5-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25080480) has the molecular formula C33H54N2O5S and a molecular weight of 590.87 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25080480 |
| Molecular Formula | C33H54N2O5S |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | hex-5-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)N([C@@H](CO)[C@@H](C)CC)C(=O)[C@H]13 |
| InChI | InChI=1S/C33H54N2O5S/c1-10-13-14-15-19-40-30(39)25-24-16-17-33(41-24)26(25)28(37)35(23(20-36)22(4)12-3)27(33)29(38)34(18-11-2)32(8,9)21-31(5,6)7/h10-11,22-27,36H,1-2,12-21H2,3-9H3/t22-,23-,24-,25+,26-,27?,33?/m0/s1 |
| InChIKey | SMBCUQRMGRPNRH-NRQFKFMRSA-N |
| XLogP | 5.61 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|