C28H44N2O5S — CID 25089787
but-3-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25089787) has the molecular formula C28H44N2O5S and a molecular weight of 520.74 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25089787 |
| Molecular Formula | C28H44N2O5S |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | but-3-enyl (5S,6R,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)C(C)CCC)N([C@@H](CO)[C@@H](C)CC)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H44N2O5S/c1-7-11-16-35-27(34)22-21-13-14-28(36-21)23(22)25(32)30(20(17-31)18(5)10-4)24(28)26(33)29(15-9-3)19(6)12-8-2/h7,9,18-24,31H,1,3,8,10-17H2,2,4-6H3/t18-,19?,20-,21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | XMUMJFHTGLHSKR-SUNASWEFSA-N |
| XLogP | 3.81 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|