C24H34N4O4S — CID 23783141
(5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783141) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783141 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (5S,6R,7S)-2-N-[4-(diethylamino)phenyl]-3-(2-hydroxyethyl)-6-N,7-dimethyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCO)C(=O)[C@@H]3[C@H](C(=O)NC)[C@]4(C)CCC23S4)cc1 |
| InChI | InChI=1S/C24H34N4O4S/c1-5-27(6-2)16-9-7-15(8-10-16)26-21(31)19-24-12-11-23(3,33-24)17(20(30)25-4)18(24)22(32)28(19)13-14-29/h7-10,17-19,29H,5-6,11-14H2,1-4H3,(H,25,30)(H,26,31)/t17-,18+,19?,23+,24?/m1/s1 |
| InChIKey | NBIPKHCOVIOXQP-HSEOZVDCSA-N |
| XLogP | 1.69 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|