C27H38BrN3O6 — CID 23954068
(5R,6R,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-pentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954068) has the molecular formula C27H38BrN3O6 and a molecular weight of 580.52 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-pentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-pentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954068 |
| Molecular Formula | C27H38BrN3O6 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (5R,6R,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-pentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)C1N([C@@H](CC)CO)C(=O)[C@@H]2[C@@H](C(=O)Nc3ccc(OCC)cc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C27H38BrN3O6/c1-4-7-8-13-29-25(34)23-27-14-19(28)22(37-27)20(21(27)26(35)31(23)17(5-2)15-32)24(33)30-16-9-11-18(12-10-16)36-6-3/h9-12,17,19-23,32H,4-8,13-15H2,1-3H3,(H,29,34)(H,30,33)/t17-,19?,20+,21-,22+,23?,27?/m0/s1 |
| InChIKey | JDHKFCBQNXSMGT-FDUBMDFUSA-N |
| XLogP | 2.85 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|