C27H38BrN3O5 — CID 23813270
(5R,6R,7S)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-N-pentyl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813270) has the molecular formula C27H38BrN3O5 and a molecular weight of 564.52 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-N-pentyl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-N-pentyl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813270 |
| Molecular Formula | C27H38BrN3O5 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (5R,6R,7S)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-N-pentyl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)C1N([C@@H](CO)[C@@H](C)CC)C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C27H38BrN3O5/c1-4-6-10-13-29-25(34)23-27-14-18(28)22(36-27)20(24(33)30-17-11-8-7-9-12-17)21(27)26(35)31(23)19(15-32)16(3)5-2/h7-9,11-12,16,18-23,32H,4-6,10,13-15H2,1-3H3,(H,29,34)(H,30,33)/t16-,18?,19-,20+,21-,22+,23?,27?/m0/s1 |
| InChIKey | VGVHKJYFUOPJMG-CNTDXNOASA-N |
| XLogP | 3.09 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|