C29H42BrN3O5S — CID 23925834
(5S,6S,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925834) has the molecular formula C29H42BrN3O5S and a molecular weight of 624.64 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925834 |
| Molecular Formula | C29H42BrN3O5S |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | (5S,6S,7S)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)C1N(C(CO)CC(C)C)C(=O)[C@@H]2[C@@H](C(=O)Nc3ccc(OCC)cc3)[C@@H]3SC12CC3Br |
| InChI | InChI=1S/C29H42BrN3O5S/c1-5-7-8-13-31-27(36)25-29-15-21(30)24(39-29)22(23(29)28(37)33(25)19(16-34)14-17(3)4)26(35)32-18-9-11-20(12-10-18)38-6-2/h9-12,17,19,21-25,34H,5-8,13-16H2,1-4H3,(H,31,36)(H,32,35)/t19?,21?,22-,23+,24-,25?,29?/m1/s1 |
| InChIKey | PBSSLVNZUGJTEP-XSOFOAMASA-N |
| XLogP | 4.20 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|