C29H34BrN3O7 — CID 23870463
(5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870463) has the molecular formula C29H34BrN3O7 and a molecular weight of 616.51 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870463 |
| Molecular Formula | C29H34BrN3O7 |
| Molecular Weight | 616.51 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N([C@@H](CC)CO)C(C(=O)Nc4ccc(OC)cc4)C34CC(Br)[C@@H]2O4)cc1 |
| InChI | InChI=1S/C29H34BrN3O7/c1-4-18(15-34)33-25(27(36)32-17-6-10-19(38-3)11-7-17)29-14-21(30)24(40-29)22(23(29)28(33)37)26(35)31-16-8-12-20(13-9-16)39-5-2/h6-13,18,21-25,34H,4-5,14-15H2,1-3H3,(H,31,35)(H,32,36)/t18-,21?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | NGRJJSHUYZTCJO-ZCRMFEBFSA-N |
| XLogP | 3.19 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|