C25H34BrN3O6 — CID 23754953
(5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754953) has the molecular formula C25H34BrN3O6 and a molecular weight of 552.47 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754953 |
| Molecular Formula | C25H34BrN3O6 |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@@H]3OC4(CC3Br)C(C(=O)NC(C)(C)C)N([C@H](C)CO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C25H34BrN3O6/c1-6-34-15-9-7-14(8-10-15)27-21(31)17-18-23(33)29(13(2)12-30)20(22(32)28-24(3,4)5)25(18)11-16(26)19(17)35-25/h7-10,13,16-20,30H,6,11-12H2,1-5H3,(H,27,31)(H,28,32)/t13-,16?,17-,18+,19-,20?,25?/m1/s1 |
| InChIKey | HCKBCNCUQPKYMM-HZNYXXLFSA-N |
| XLogP | 2.07 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|