C26H34BrN3O5 — CID 23755291
(5R,6S,7R)-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755291) has the molecular formula C26H34BrN3O5 and a molecular weight of 548.48 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755291 |
| Molecular Formula | C26H34BrN3O5 |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C26H34BrN3O5/c27-18-15-26-20(19(21(18)35-26)23(32)28-16-9-3-1-4-10-16)25(34)30(13-7-8-14-31)22(26)24(33)29-17-11-5-2-6-12-17/h1,3-4,9-10,17-22,31H,2,5-8,11-15H2,(H,28,32)(H,29,33)/t18?,19-,20-,21-,22?,26?/m0/s1 |
| InChIKey | ITYGZXZQDNYTDW-NRNGZIOXSA-N |
| XLogP | 2.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|