C29H40BrN3O6 — CID 23894777
ethyl (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23894777) has the molecular formula C29H40BrN3O6 and a molecular weight of 606.56 g/mol. Its IUPAC name is ethyl (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23894777 |
| Molecular Formula | C29H40BrN3O6 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | ethyl (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@@H](CC)CO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3OC12CC3Br)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C29H40BrN3O6/c1-6-15-32(20-13-11-19(12-14-20)31(8-3)9-4)27(36)25-29-16-21(30)24(39-29)22(28(37)38-10-5)23(29)26(35)33(25)18(7-2)17-34/h6,11-14,18,21-25,34H,1,7-10,15-17H2,2-5H3/t18-,21?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | CGOPWTCZRGLIEM-ZCRMFEBFSA-N |
| XLogP | 3.13 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|