C31H43BrN4O5 — CID 23982232
(5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982232) has the molecular formula C31H43BrN4O5 and a molecular weight of 631.61 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982232 |
| Molecular Formula | C31H43BrN4O5 |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C31H43BrN4O5/c1-7-16-33(6)28(38)24-25-29(39)36(20(9-3)19-37)27(31(25)18-23(32)26(24)41-31)30(40)35(17-8-2)22-14-12-21(13-15-22)34(10-4)11-5/h7-8,12-15,20,23-27,37H,1-2,9-11,16-19H2,3-6H3/t20-,23?,24-,25-,26-,27?,31?/m0/s1 |
| InChIKey | YBEQYWXNCSNAJD-JHOBPBFASA-N |
| XLogP | 3.22 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|