C27H36BrN3O6 — CID 23871982
(1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23871982) has the molecular formula C27H36BrN3O6 and a molecular weight of 578.50 g/mol. Its IUPAC name is (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23871982 |
| Molecular Formula | C27H36BrN3O6 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)[C@H]1N([C@@H](CC)CO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@H]3O[C@@]21CC3Br)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C27H36BrN3O6/c1-5-13-30(18-11-9-17(10-12-18)29(7-3)8-4)25(34)23-27-14-19(28)22(37-27)20(26(35)36)21(27)24(33)31(23)16(6-2)15-32/h5,9-12,16,19-23,32H,1,6-8,13-15H2,2-4H3,(H,35,36)/t16-,19?,20+,21-,22+,23+,27-/m0/s1 |
| InChIKey | CSPHVOLZUQEGGW-JVTKGXAPSA-N |
| XLogP | 2.66 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|