C31H36BrN3O6 — CID 23782232
(5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23782232) has the molecular formula C31H36BrN3O6 and a molecular weight of 626.55 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23782232 |
| Molecular Formula | C31H36BrN3O6 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N([C@H](CO)c2ccccc2)C(=O)[C@@H]2[C@H](C(=O)O)[C@H]3OC12CC3Br)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C31H36BrN3O6/c1-4-16-34(21-14-12-20(13-15-21)33(5-2)6-3)29(38)27-31-17-22(32)26(41-31)24(30(39)40)25(31)28(37)35(27)23(18-36)19-10-8-7-9-11-19/h4,7-15,22-27,36H,1,5-6,16-18H2,2-3H3,(H,39,40)/t22?,23-,24+,25+,26+,27?,31?/m1/s1 |
| InChIKey | XTMIPGPGHPDTOY-VYQZRWHHSA-N |
| XLogP | 3.62 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|