C25H32BrClN2O6 — CID 23810003
ethyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23810003) has the molecular formula C25H32BrClN2O6 and a molecular weight of 571.90 g/mol. Its IUPAC name is ethyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23810003 |
| Molecular Formula | C25H32BrClN2O6 |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | ethyl (5R,6S,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc3c(C)cccc3Cl)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C25H32BrClN2O6/c1-5-12(3)16(11-30)29-21(22(31)28-19-13(4)8-7-9-15(19)27)25-10-14(26)20(35-25)17(18(25)23(29)32)24(33)34-6-2/h7-9,12,14,16-18,20-21,30H,5-6,10-11H2,1-4H3,(H,28,31)/t12-,14?,16-,17-,18-,20-,21?,25?/m0/s1 |
| InChIKey | DOZVSUWMPNOMOS-JAVIFJJCSA-N |
| XLogP | 3.31 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|